C36H55F3O4 — CID 56622801
[4-[3-fluoro-4-[4-[(2S)-2-fluorononanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorononanoate (PubChem CID 56622801) has the molecular formula C36H55F3O4 and a molecular weight of 608.83 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-[(2S)-2-fluorononanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorononanoate.
| Compound Name | [4-[3-fluoro-4-[4-[(2S)-2-fluorononanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorononanoate |
|---|---|
| PubChem CID | 56622801 |
| Molecular Formula | C36H55F3O4 |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | [4-[3-fluoro-4-[4-[(2S)-2-fluorononanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorononanoate |
| SMILES | CCCCCCC[C@H](F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)[C@@H](F)CCCCCCC)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C36H55F3O4/c1-3-5-7-9-11-13-32(37)35(40)42-29-20-15-26(16-21-29)28-19-24-31(34(39)25-28)27-17-22-30(23-18-27)43-36(41)33(38)14-12-10-8-6-4-2/h19,24-27,29-30,32-33H,3-18,20-23H2,1-2H3/t26?,27?,29?,30?,32-,33-/m0/s1 |
| InChIKey | SDRRNSNETJJWFH-CIDQTRPKSA-N |
| XLogP | 10.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|