C30H44F2O4 — CID 56638055
[4-[4-[4-[(2R)-2-fluorohexanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2R)-2-fluorohexanoate (PubChem CID 56638055) has the molecular formula C30H44F2O4 and a molecular weight of 506.67 g/mol. Its IUPAC name is [4-[4-[4-[(2R)-2-fluorohexanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2R)-2-fluorohexanoate.
| Compound Name | [4-[4-[4-[(2R)-2-fluorohexanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2R)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56638055 |
| Molecular Formula | C30H44F2O4 |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [4-[4-[4-[(2R)-2-fluorohexanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2R)-2-fluorohexanoate |
| SMILES | CCCC[C@@H](F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)[C@H](F)CCCC)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H44F2O4/c1-3-5-7-27(31)29(33)35-25-17-13-23(14-18-25)21-9-11-22(12-10-21)24-15-19-26(20-16-24)36-30(34)28(32)8-6-4-2/h9-12,23-28H,3-8,13-20H2,1-2H3/t23?,24?,25?,26?,27-,28-/m1/s1 |
| InChIKey | OXWRTDIXBCFXOO-RSLMILFBSA-N |
| XLogP | 7.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |