C35H48FNO3 — CID 56609277
[4-[4-(3-cyano-4-decoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56609277) has the molecular formula C35H48FNO3 and a molecular weight of 549.77 g/mol. Its IUPAC name is [4-[4-(3-cyano-4-decoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[4-(3-cyano-4-decoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56609277 |
| Molecular Formula | C35H48FNO3 |
| Molecular Weight | 549.77 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | [4-[4-(3-cyano-4-decoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)cc1C#N |
| InChI | InChI=1S/C35H48FNO3/c1-3-5-7-8-9-10-11-12-24-39-34-23-20-30(25-31(34)26-37)29-16-14-27(15-17-29)28-18-21-32(22-19-28)40-35(38)33(36)13-6-4-2/h14-17,20,23,25,28,32-33H,3-13,18-19,21-22,24H2,1-2H3/t28?,32?,33-/m0/s1 |
| InChIKey | NOKZKKNESWFZLW-JEPYXASLSA-N |
| XLogP | 9.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.77 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|