C27H37FN2O2 — CID 56626319
[4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56626319) has the molecular formula C27H37FN2O2 and a molecular weight of 440.60 g/mol. Its IUPAC name is [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56626319 |
| Molecular Formula | C27H37FN2O2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCc1cnc(-c2ccc(C3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C27H37FN2O2/c1-3-5-7-8-20-18-29-26(30-19-20)23-12-10-21(11-13-23)22-14-16-24(17-15-22)32-27(31)25(28)9-6-4-2/h10-13,18-19,22,24-25H,3-9,14-17H2,1-2H3/t22?,24?,25-/m0/s1 |
| InChIKey | WCIHTUBLMDTWJI-DWJCEPTDSA-N |
| XLogP | 6.97 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|