C28H38F2N2O3 — CID 54073584
[4-[[2-fluoro-4-(5-pentylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 54073584) has the molecular formula C28H38F2N2O3 and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-[[2-fluoro-4-(5-pentylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[[2-fluoro-4-(5-pentylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 54073584 |
| Molecular Formula | C28H38F2N2O3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | [4-[[2-fluoro-4-(5-pentylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCc1cnc(-c2ccc(OCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)c(F)c2)nc1 |
| InChI | InChI=1S/C28H38F2N2O3/c1-3-5-7-8-21-17-31-27(32-18-21)22-12-15-26(25(30)16-22)34-19-20-10-13-23(14-11-20)35-28(33)24(29)9-6-4-2/h12,15-18,20,23-24H,3-11,13-14,19H2,1-2H3/t20?,23?,24-/m0/s1 |
| InChIKey | MIDXDQNSBGAKSL-BOYUCYPVSA-N |
| XLogP | 7.02 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|