C30H43FN2O2 — CID 21246815
(4-propylcyclohexyl) 4-(5-decylpyrimidin-2-yl)-2-fluorobenzoate (PubChem CID 21246815) has the molecular formula C30H43FN2O2 and a molecular weight of 482.68 g/mol. Its IUPAC name is (4-propylcyclohexyl) 4-(5-decylpyrimidin-2-yl)-2-fluorobenzoate.
| Compound Name | (4-propylcyclohexyl) 4-(5-decylpyrimidin-2-yl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 21246815 |
| Molecular Formula | C30H43FN2O2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | (4-propylcyclohexyl) 4-(5-decylpyrimidin-2-yl)-2-fluorobenzoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(C(=O)OC3CCC(CCC)CC3)c(F)c2)nc1 |
| InChI | InChI=1S/C30H43FN2O2/c1-3-5-6-7-8-9-10-11-13-24-21-32-29(33-22-24)25-16-19-27(28(31)20-25)30(34)35-26-17-14-23(12-4-2)15-18-26/h16,19-23,26H,3-15,17-18H2,1-2H3 |
| InChIKey | BOLVPLKCTXPALD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|