C31H45FN2O2 — CID 21246978
(4-heptylcyclohexyl) 2-fluoro-4-(5-heptylpyrimidin-2-yl)benzoate (PubChem CID 21246978) has the molecular formula C31H45FN2O2 and a molecular weight of 496.71 g/mol. Its IUPAC name is (4-heptylcyclohexyl) 2-fluoro-4-(5-heptylpyrimidin-2-yl)benzoate.
| Compound Name | (4-heptylcyclohexyl) 2-fluoro-4-(5-heptylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 21246978 |
| Molecular Formula | C31H45FN2O2 |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | (4-heptylcyclohexyl) 2-fluoro-4-(5-heptylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(C(=O)OC3CCC(CCCCCCC)CC3)c(F)c2)nc1 |
| InChI | InChI=1S/C31H45FN2O2/c1-3-5-7-9-11-13-24-15-18-27(19-16-24)36-31(35)28-20-17-26(21-29(28)32)30-33-22-25(23-34-30)14-12-10-8-6-4-2/h17,20-24,27H,3-16,18-19H2,1-2H3 |
| InChIKey | IHSIPIVMRKQAMQ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|