C25H32F2N2O3 — CID 56633922
[4-[[4-(5-ethylpyrimidin-2-yl)-2-fluorophenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56633922) has the molecular formula C25H32F2N2O3 and a molecular weight of 446.54 g/mol. Its IUPAC name is [4-[[4-(5-ethylpyrimidin-2-yl)-2-fluorophenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[[4-(5-ethylpyrimidin-2-yl)-2-fluorophenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56633922 |
| Molecular Formula | C25H32F2N2O3 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [4-[[4-(5-ethylpyrimidin-2-yl)-2-fluorophenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(COc2ccc(-c3ncc(CC)cn3)cc2F)CC1 |
| InChI | InChI=1S/C25H32F2N2O3/c1-3-5-6-21(26)25(30)32-20-10-7-18(8-11-20)16-31-23-12-9-19(13-22(23)27)24-28-14-17(4-2)15-29-24/h9,12-15,18,20-21H,3-8,10-11,16H2,1-2H3/t18?,20?,21-/m0/s1 |
| InChIKey | UXWSULQMMULTBA-MNLRITNHSA-N |
| XLogP | 5.85 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |