C33H49FN2O3 — CID 54489674
[4-[[4-(5-nonylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluoroheptanoate (PubChem CID 54489674) has the molecular formula C33H49FN2O3 and a molecular weight of 540.76 g/mol. Its IUPAC name is [4-[[4-(5-nonylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluoroheptanoate.
| Compound Name | [4-[[4-(5-nonylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluoroheptanoate |
|---|---|
| PubChem CID | 54489674 |
| Molecular Formula | C33H49FN2O3 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | [4-[[4-(5-nonylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluoroheptanoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(OCC3CCC(OC(=O)[C@@H](F)CCCCC)CC3)cc2)nc1 |
| InChI | InChI=1S/C33H49FN2O3/c1-3-5-7-8-9-10-12-13-27-23-35-32(36-24-27)28-17-21-29(22-18-28)38-25-26-15-19-30(20-16-26)39-33(37)31(34)14-11-6-4-2/h17-18,21-24,26,30-31H,3-16,19-20,25H2,1-2H3/t26?,30?,31-/m0/s1 |
| InChIKey | XUVGEPSAXWQKCF-OYDDBBPWSA-N |
| XLogP | 8.84 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|