C25H30FN3O3 — CID 54095339
[4-[[2-cyano-4-(5-methylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 54095339) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is [4-[[2-cyano-4-(5-methylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[[2-cyano-4-(5-methylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 54095339 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [4-[[2-cyano-4-(5-methylpyrimidin-2-yl)phenoxy]methyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(COc2ccc(-c3ncc(C)cn3)cc2C#N)CC1 |
| InChI | InChI=1S/C25H30FN3O3/c1-3-4-5-22(26)25(30)32-21-9-6-18(7-10-21)16-31-23-11-8-19(12-20(23)13-27)24-28-14-17(2)15-29-24/h8,11-12,14-15,18,21-22H,3-7,9-10,16H2,1-2H3/t18?,21?,22-/m0/s1 |
| InChIKey | MWSAEZKRFPANJB-UDJZJCJKSA-N |
| XLogP | 5.33 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |