C39H59F2NO4 — CID 18960278
[4-[3-cyano-4-[4-(2-fluorodecanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorodecanoate (PubChem CID 18960278) has the molecular formula C39H59F2NO4 and a molecular weight of 643.90 g/mol. Its IUPAC name is [4-[3-cyano-4-[4-(2-fluorodecanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorodecanoate.
| Compound Name | [4-[3-cyano-4-[4-(2-fluorodecanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorodecanoate |
|---|---|
| PubChem CID | 18960278 |
| Molecular Formula | C39H59F2NO4 |
| Molecular Weight | 643.90 g/mol |
| Exact Mass | 643.44 |
| IUPAC Name | [4-[3-cyano-4-[4-(2-fluorodecanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorodecanoate |
| SMILES | CCCCCCCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCCCCCCC)CC3)c(C#N)c2)CC1 |
| InChI | InChI=1S/C39H59F2NO4/c1-3-5-7-9-11-13-15-36(40)38(43)45-33-22-17-29(18-23-33)31-21-26-35(32(27-31)28-42)30-19-24-34(25-20-30)46-39(44)37(41)16-14-12-10-8-6-4-2/h21,26-27,29-30,33-34,36-37H,3-20,22-25H2,1-2H3 |
| InChIKey | NTBFCXRWLLSHHF-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.90 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|