C26H33FO3 — CID 56609874
[4-[4-(4-ethoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56609874) has the molecular formula C26H33FO3 and a molecular weight of 412.55 g/mol. Its IUPAC name is [4-[4-(4-ethoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[4-(4-ethoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56609874 |
| Molecular Formula | C26H33FO3 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [4-[4-(4-ethoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(c2ccc(-c3ccc(OCC)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H33FO3/c1-3-5-6-25(27)26(28)30-24-17-13-22(14-18-24)20-9-7-19(8-10-20)21-11-15-23(16-12-21)29-4-2/h7-12,15-16,22,24-25H,3-6,13-14,17-18H2,1-2H3/t22?,24?,25-/m0/s1 |
| InChIKey | CFBXUXDPXKISBC-DWJCEPTDSA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |