C38H59ClF2O4 — CID 56618228
[4-[3-chloro-4-[4-[(2S)-2-fluorodecanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorodecanoate (PubChem CID 56618228) has the molecular formula C38H59ClF2O4 and a molecular weight of 653.33 g/mol. Its IUPAC name is [4-[3-chloro-4-[4-[(2S)-2-fluorodecanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorodecanoate.
| Compound Name | [4-[3-chloro-4-[4-[(2S)-2-fluorodecanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorodecanoate |
|---|---|
| PubChem CID | 56618228 |
| Molecular Formula | C38H59ClF2O4 |
| Molecular Weight | 653.33 g/mol |
| Exact Mass | 652.41 |
| IUPAC Name | [4-[3-chloro-4-[4-[(2S)-2-fluorodecanoyl]oxycyclohexyl]phenyl]cyclohexyl] (2S)-2-fluorodecanoate |
| SMILES | CCCCCCCC[C@H](F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)[C@@H](F)CCCCCCCC)CC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C38H59ClF2O4/c1-3-5-7-9-11-13-15-35(40)37(42)44-31-22-17-28(18-23-31)30-21-26-33(34(39)27-30)29-19-24-32(25-20-29)45-38(43)36(41)16-14-12-10-8-6-4-2/h21,26-29,31-32,35-36H,3-20,22-25H2,1-2H3/t28?,29?,31?,32?,35-,36-/m0/s1 |
| InChIKey | MLOCGTJEVNAICY-XBBQGYJXSA-N |
| XLogP | 11.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.33 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|