C29H38BrFO3 — CID 56624090
[4-[4-(3-bromo-4-pentoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56624090) has the molecular formula C29H38BrFO3 and a molecular weight of 533.52 g/mol. Its IUPAC name is [4-[4-(3-bromo-4-pentoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[4-(3-bromo-4-pentoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56624090 |
| Molecular Formula | C29H38BrFO3 |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [4-[4-(3-bromo-4-pentoxyphenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCOc1ccc(-c2ccc(C3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)cc1Br |
| InChI | InChI=1S/C29H38BrFO3/c1-3-5-7-19-33-28-18-15-24(20-26(28)30)23-11-9-21(10-12-23)22-13-16-25(17-14-22)34-29(32)27(31)8-6-4-2/h9-12,15,18,20,22,25,27H,3-8,13-14,16-17,19H2,1-2H3/t22?,25?,27-/m0/s1 |
| InChIKey | BKNSVUMRXNTAOJ-BCFFDTETSA-N |
| XLogP | 8.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|