C34H48BrFO3 — CID 56611291
[4-[2-[4-[3-bromo-4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56611291) has the molecular formula C34H48BrFO3 and a molecular weight of 603.66 g/mol. Its IUPAC name is [4-[2-[4-[3-bromo-4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[2-[4-[3-bromo-4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56611291 |
| Molecular Formula | C34H48BrFO3 |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | [4-[2-[4-[3-bromo-4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCC[C@H](C)Oc1ccc(-c2ccc(CCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)cc1Br |
| InChI | InChI=1S/C34H48BrFO3/c1-4-6-8-9-10-25(3)38-33-23-20-29(24-31(33)35)28-18-14-26(15-19-28)12-13-27-16-21-30(22-17-27)39-34(37)32(36)11-7-5-2/h14-15,18-20,23-25,27,30,32H,4-13,16-17,21-22H2,1-3H3/t25-,27?,30?,32-/m0/s1 |
| InChIKey | VDTMVRJDQXWGNF-SUEROFSKSA-N |
| XLogP | 10.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|