C34H49FO3 — CID 56611968
[4-[2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56611968) has the molecular formula C34H49FO3 and a molecular weight of 524.76 g/mol. Its IUPAC name is [4-[2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56611968 |
| Molecular Formula | C34H49FO3 |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | [4-[2-[4-[4-[(2S)-octan-2-yl]oxyphenyl]phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCC[C@H](C)Oc1ccc(-c2ccc(CCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H49FO3/c1-4-6-8-9-10-26(3)37-31-24-20-30(21-25-31)29-18-14-27(15-19-29)12-13-28-16-22-32(23-17-28)38-34(36)33(35)11-7-5-2/h14-15,18-21,24-26,28,32-33H,4-13,16-17,22-23H2,1-3H3/t26-,28?,32?,33-/m0/s1 |
| InChIKey | GHCCCWJBBWOJCM-WXBLHDPCSA-N |
| XLogP | 9.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|