C37H52F2O5 — CID 56618678
[4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 4-decoxy-2-fluorobenzoate (PubChem CID 56618678) has the molecular formula C37H52F2O5 and a molecular weight of 614.81 g/mol. Its IUPAC name is [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 4-decoxy-2-fluorobenzoate.
| Compound Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 4-decoxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 56618678 |
| Molecular Formula | C37H52F2O5 |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 4-decoxy-2-fluorobenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(CCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C37H52F2O5/c1-3-5-7-8-9-10-11-12-26-42-32-24-25-33(35(39)27-32)36(40)43-30-20-16-28(17-21-30)14-15-29-18-22-31(23-19-29)44-37(41)34(38)13-6-4-2/h16-17,20-21,24-25,27,29,31,34H,3-15,18-19,22-23,26H2,1-2H3/t29?,31?,34-/m0/s1 |
| InChIKey | OCSLZXFKBMCWQP-QPXMQMQXSA-N |
| XLogP | 10.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|