C35H48F2O5 — CID 56619707
[4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 2-fluoro-4-octoxybenzoate (PubChem CID 56619707) has the molecular formula C35H48F2O5 and a molecular weight of 586.76 g/mol. Its IUPAC name is [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 2-fluoro-4-octoxybenzoate.
| Compound Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 2-fluoro-4-octoxybenzoate |
|---|---|
| PubChem CID | 56619707 |
| Molecular Formula | C35H48F2O5 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 2-fluoro-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(CCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C35H48F2O5/c1-3-5-7-8-9-10-24-40-30-22-23-31(33(37)25-30)34(38)41-28-18-14-26(15-19-28)12-13-27-16-20-29(21-17-27)42-35(39)32(36)11-6-4-2/h14-15,18-19,22-23,25,27,29,32H,3-13,16-17,20-21,24H2,1-2H3/t27?,29?,32-/m0/s1 |
| InChIKey | NJFHDLYWPSXYBO-GHIDTHINSA-N |
| XLogP | 9.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|