C28H34F2O5 — CID 56612332
[4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 3-fluoro-4-methoxybenzoate (PubChem CID 56612332) has the molecular formula C28H34F2O5 and a molecular weight of 488.57 g/mol. Its IUPAC name is [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 56612332 |
| Molecular Formula | C28H34F2O5 |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [4-[2-[4-[(2S)-2-fluorohexanoyl]oxycyclohexyl]ethyl]phenyl] 3-fluoro-4-methoxybenzoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(CCc2ccc(OC(=O)c3ccc(OC)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C28H34F2O5/c1-3-4-5-24(29)28(32)35-23-15-10-20(11-16-23)7-6-19-8-13-22(14-9-19)34-27(31)21-12-17-26(33-2)25(30)18-21/h8-9,12-14,17-18,20,23-24H,3-7,10-11,15-16H2,1-2H3/t20?,23?,24-/m0/s1 |
| InChIKey | MROPTYSIWXZUKM-BOYUCYPVSA-N |
| XLogP | 6.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|