C27H34ClFO3 — CID 56609631
[4-[2-[4-(3-chloro-4-methoxyphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56609631) has the molecular formula C27H34ClFO3 and a molecular weight of 461.02 g/mol. Its IUPAC name is [4-[2-[4-(3-chloro-4-methoxyphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[2-[4-(3-chloro-4-methoxyphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56609631 |
| Molecular Formula | C27H34ClFO3 |
| Molecular Weight | 461.02 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | [4-[2-[4-(3-chloro-4-methoxyphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(CCc2ccc(-c3ccc(OC)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C27H34ClFO3/c1-3-4-5-25(29)27(30)32-23-15-10-20(11-16-23)7-6-19-8-12-21(13-9-19)22-14-17-26(31-2)24(28)18-22/h8-9,12-14,17-18,20,23,25H,3-7,10-11,15-16H2,1-2H3/t20?,23?,25-/m0/s1 |
| InChIKey | BBQNFEJQFVSWTB-QNAFOZIXSA-N |
| XLogP | 7.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.02 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |