C31H43FO2 — CID 56615612
[4-[2-[4-(4-pentylphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56615612) has the molecular formula C31H43FO2 and a molecular weight of 466.68 g/mol. Its IUPAC name is [4-[2-[4-(4-pentylphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[2-[4-(4-pentylphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56615612 |
| Molecular Formula | C31H43FO2 |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | [4-[2-[4-(4-pentylphenyl)phenyl]ethyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCCCc1ccc(-c2ccc(CCC3CCC(OC(=O)[C@@H](F)CCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H43FO2/c1-3-5-7-8-24-12-18-27(19-13-24)28-20-14-25(15-21-28)10-11-26-16-22-29(23-17-26)34-31(33)30(32)9-6-4-2/h12-15,18-21,26,29-30H,3-11,16-17,22-23H2,1-2H3/t26?,29?,30-/m0/s1 |
| InChIKey | OMGLXQRIIRYFCY-YMFGIUHLSA-N |
| XLogP | 8.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|