C26H32F2O3 — CID 56607354
[4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate (PubChem CID 56607354) has the molecular formula C26H32F2O3 and a molecular weight of 430.54 g/mol. Its IUPAC name is [4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate.
| Compound Name | [4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
|---|---|
| PubChem CID | 56607354 |
| Molecular Formula | C26H32F2O3 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [4-[4-(4-ethoxy-3-fluorophenyl)phenyl]cyclohexyl] (2S)-2-fluorohexanoate |
| SMILES | CCCC[C@H](F)C(=O)OC1CCC(c2ccc(-c3ccc(OCC)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H32F2O3/c1-3-5-6-23(27)26(29)31-22-14-11-19(12-15-22)18-7-9-20(10-8-18)21-13-16-25(30-4-2)24(28)17-21/h7-10,13,16-17,19,22-23H,3-6,11-12,14-15H2,1-2H3/t19?,22?,23-/m0/s1 |
| InChIKey | QHMMYDOZDUNDKM-HXJXPZHGSA-N |
| XLogP | 6.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |