C28H39ClF2O4 — CID 18960221
[4-[3-chloro-4-[4-(2-fluoropentanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoropentanoate (PubChem CID 18960221) has the molecular formula C28H39ClF2O4 and a molecular weight of 513.07 g/mol. Its IUPAC name is [4-[3-chloro-4-[4-(2-fluoropentanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoropentanoate.
| Compound Name | [4-[3-chloro-4-[4-(2-fluoropentanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoropentanoate |
|---|---|
| PubChem CID | 18960221 |
| Molecular Formula | C28H39ClF2O4 |
| Molecular Weight | 513.07 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | [4-[3-chloro-4-[4-(2-fluoropentanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoropentanoate |
| SMILES | CCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCC)CC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H39ClF2O4/c1-3-5-25(30)27(32)34-21-12-7-18(8-13-21)20-11-16-23(24(29)17-20)19-9-14-22(15-10-19)35-28(33)26(31)6-4-2/h11,16-19,21-22,25-26H,3-10,12-15H2,1-2H3 |
| InChIKey | NLDXUCYUJNHCLI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.07 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |