C25H32N2O2 — CID 54097334
[4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] but-2-enoate (PubChem CID 54097334) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] but-2-enoate.
| Compound Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] but-2-enoate |
|---|---|
| PubChem CID | 54097334 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | [4-[4-(5-pentylpyrimidin-2-yl)phenyl]cyclohexyl] but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC(c2ccc(-c3ncc(CCCCC)cn3)cc2)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-3-5-6-8-19-17-26-25(27-18-19)22-11-9-20(10-12-22)21-13-15-23(16-14-21)29-24(28)7-4-2/h4,7,9-12,17-18,21,23H,3,5-6,8,13-16H2,1-2H3 |
| InChIKey | MYAVSZIHSHTTJS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|