About [4-(4-cyanophenyl)cyclohexyl] but-2-enoate
[4-(4-cyanophenyl)cyclohexyl] but-2-enoate (PubChem CID 54231176) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is [4-(4-cyanophenyl)cyclohexyl] but-2-enoate.
Molecular Properties
| Compound Name | [4-(4-cyanophenyl)cyclohexyl] but-2-enoate |
| PubChem CID | 54231176 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [4-(4-cyanophenyl)cyclohexyl] but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C17H19NO2/c1-2-3-17(19)20-16-10-8-15(9-11-16)14-6-4-13(12-18)5-7-14/h2-7,15-16H,8-11H2,1H3 |
| InChIKey | QJJFVTMMENDVHY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-cyanophenyl)cyclohexyl] but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-cyanophenyl)cyclohexyl] but-2-enoate?
The IUPAC name of [4-(4-cyanophenyl)cyclohexyl] but-2-enoate (CID 54231176) is [4-(4-cyanophenyl)cyclohexyl] but-2-enoate.
What is the SMILES notation for [4-(4-cyanophenyl)cyclohexyl] but-2-enoate?
The canonical SMILES for [4-(4-cyanophenyl)cyclohexyl] but-2-enoate is CC=CC(=O)OC1CCC(c2ccc(C#N)cc2)CC1.
What is the InChIKey of [4-(4-cyanophenyl)cyclohexyl] but-2-enoate?
The InChIKey is QJJFVTMMENDVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-2-3-17(19)20-16-10-8-15(9-11-16)14-6-4-13(12-18)5-7-14/h2-7,15-16H,8-11H2,1H3.
What are the key properties of [4-(4-cyanophenyl)cyclohexyl] but-2-enoate?
[4-(4-cyanophenyl)cyclohexyl] but-2-enoate has a molecular weight of 269.34 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-cyanophenyl)cyclohexyl] but-2-enoate is sourced from PubChem (CID 54231176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).