C23H28FNO2 — CID 54313205
[4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl] but-2-enoate (PubChem CID 54313205) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is [4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl] but-2-enoate.
| Compound Name | [4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl] but-2-enoate |
|---|---|
| PubChem CID | 54313205 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl] but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC(C2CCC(c3ccc(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H28FNO2/c1-2-3-23(26)27-21-12-10-17(11-13-21)16-4-6-18(7-5-16)19-8-9-20(15-25)22(24)14-19/h2-3,8-9,14,16-18,21H,4-7,10-13H2,1H3 |
| InChIKey | SMIIUSCPVQCKRO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|