C20H24FN — CID 58840005
2-fluoro-4-[5,5,7,7-tetradeuterio-6-[(E)-prop-1-enyl]-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl]benzonitrile (PubChem CID 58840005) has the molecular formula C20H24FN and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-fluoro-4-[5,5,7,7-tetradeuterio-6-[(E)-prop-1-enyl]-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[5,5,7,7-tetradeuterio-6-[(E)-prop-1-enyl]-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 58840005 |
| Molecular Formula | C20H24FN |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | 2-fluoro-4-[5,5,7,7-tetradeuterio-6-[(E)-prop-1-enyl]-1,2,3,4,4a,6,8,8a-octahydronaphthalen-2-yl]benzonitrile |
| SMILES | [2H]C1([2H])CC2CC(c3ccc(C#N)c(F)c3)CCC2C([2H])([2H])C1/C=C/C |
| InChI | InChI=1S/C20H24FN/c1-2-3-14-4-5-16-11-17(7-6-15(16)10-14)18-8-9-19(13-22)20(21)12-18/h2-3,8-9,12,14-17H,4-7,10-11H2,1H3/b3-2+/i4D2,10D2 |
| InChIKey | ADQKJVDNHGPKKD-MRZWMYJYSA-N |
| XLogP | 5.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|