C13H13F2N — CID 18344277
2-fluoro-4-(4-fluorocyclohexyl)benzonitrile (PubChem CID 18344277) has the molecular formula C13H13F2N and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-fluoro-4-(4-fluorocyclohexyl)benzonitrile.
| Compound Name | 2-fluoro-4-(4-fluorocyclohexyl)benzonitrile |
|---|---|
| PubChem CID | 18344277 |
| Molecular Formula | C13H13F2N |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-fluoro-4-(4-fluorocyclohexyl)benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(F)CC2)cc1F |
| InChI | InChI=1S/C13H13F2N/c14-12-5-3-9(4-6-12)10-1-2-11(8-16)13(15)7-10/h1-2,7,9,12H,3-6H2 |
| InChIKey | LGFQKPBBQGULGD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |