C23H28FNO2 — CID 67844128
2-[4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid (PubChem CID 67844128) has the molecular formula C23H28FNO2 and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-[4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid.
| Compound Name | 2-[4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid |
|---|---|
| PubChem CID | 67844128 |
| Molecular Formula | C23H28FNO2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-[4-[4-(4-cyano-3-fluorophenyl)cyclohexyl]cyclohexyl]but-3-enoic acid |
| SMILES | C=CC(C(=O)O)C1CCC(C2CCC(c3ccc(C#N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H28FNO2/c1-2-21(23(26)27)18-9-7-16(8-10-18)15-3-5-17(6-4-15)19-11-12-20(14-25)22(24)13-19/h2,11-13,15-18,21H,1,3-10H2,(H,26,27) |
| InChIKey | NUKXGZWCXXPXJS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|