C22H20FNO2 — CID 19938000
(4-cyano-3-fluorophenyl) 4-(4-ethenylcyclohexyl)benzoate (PubChem CID 19938000) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-(4-ethenylcyclohexyl)benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-(4-ethenylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 19938000 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-(4-ethenylcyclohexyl)benzoate |
| SMILES | C=CC1CCC(c2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H20FNO2/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)22(25)26-20-12-11-19(14-24)21(23)13-20/h2,7-13,15-16H,1,3-6H2 |
| InChIKey | RIPIOBMFVUEQIX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|