C26H28F2O3 — CID 139866778
(3,5-difluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139866778) has the molecular formula C26H28F2O3 and a molecular weight of 426.50 g/mol. Its IUPAC name is (3,5-difluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (3,5-difluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139866778 |
| Molecular Formula | C26H28F2O3 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (3,5-difluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CC1CCC2CC(c3ccc(C(=O)Oc4cc(F)c(OC)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C26H28F2O3/c1-3-16-4-5-21-13-20(11-10-19(21)12-16)17-6-8-18(9-7-17)26(29)31-22-14-23(27)25(30-2)24(28)15-22/h3,6-9,14-16,19-21H,1,4-5,10-13H2,2H3 |
| InChIKey | XSIFKCLWOPPFOV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|