C26H28F2O2 — CID 139867146
(3-fluoro-4-methylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate (PubChem CID 139867146) has the molecular formula C26H28F2O2 and a molecular weight of 410.50 g/mol. Its IUPAC name is (3-fluoro-4-methylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate.
| Compound Name | (3-fluoro-4-methylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 139867146 |
| Molecular Formula | C26H28F2O2 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3-fluoro-4-methylphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-fluorobenzoate |
| SMILES | C=CC1CCC2CC(c3ccc(C(=O)Oc4ccc(C)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C26H28F2O2/c1-3-17-5-6-19-13-20(8-7-18(19)12-17)21-9-11-23(25(28)14-21)26(29)30-22-10-4-16(2)24(27)15-22/h3-4,9-11,14-15,17-20H,1,5-8,12-13H2,2H3 |
| InChIKey | FGXOKVOFBTZQJQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|