C26H29FO3 — CID 139869555
(3-fluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139869555) has the molecular formula C26H29FO3 and a molecular weight of 408.51 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (3-fluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139869555 |
| Molecular Formula | C26H29FO3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl) 4-(6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CC1CCC2CC(c3ccc(C(=O)Oc4ccc(OC)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C26H29FO3/c1-3-17-4-5-22-15-21(11-10-20(22)14-17)18-6-8-19(9-7-18)26(28)30-23-12-13-25(29-2)24(27)16-23/h3,6-9,12-13,16-17,20-22H,1,4-5,10-11,14-15H2,2H3 |
| InChIKey | KYQRTZZPBQROKH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|