C27H30F2O2 — CID 139867912
(3,5-difluoro-4-methylphenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139867912) has the molecular formula C27H30F2O2 and a molecular weight of 424.53 g/mol. Its IUPAC name is (3,5-difluoro-4-methylphenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (3,5-difluoro-4-methylphenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139867912 |
| Molecular Formula | C27H30F2O2 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (3,5-difluoro-4-methylphenyl) 4-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/C1CCC2CC(c3ccc(C(=O)Oc4cc(F)c(C)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C27H30F2O2/c1-3-4-18-5-6-23-14-22(12-11-21(23)13-18)19-7-9-20(10-8-19)27(30)31-24-15-25(28)17(2)26(29)16-24/h3-4,7-10,15-16,18,21-23H,5-6,11-14H2,1-2H3/b4-3+ |
| InChIKey | GHVKVSVJUVYTBT-ONEGZZNKSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|