C28H31F3O2 — CID 139867469
(3,4,5-trifluorophenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139867469) has the molecular formula C28H31F3O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139867469 |
| Molecular Formula | C28H31F3O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C28H31F3O2/c1-2-3-4-5-18-6-7-23-15-22(13-12-21(23)14-18)19-8-10-20(11-9-19)28(32)33-24-16-25(29)27(31)26(30)17-24/h2-3,8-11,16-18,21-23H,4-7,12-15H2,1H3/b3-2+ |
| InChIKey | ISDJSRSPPRTGBB-NSCUHMNNSA-N |
| XLogP | 7.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|