C29H36O3 — CID 139869709
(4-methoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate (PubChem CID 139869709) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate.
| Compound Name | (4-methoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
|---|---|
| PubChem CID | 139869709 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (4-methoxyphenyl) 4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]benzoate |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C(=O)Oc4ccc(OC)cc4)cc3)CCC2C1 |
| InChI | InChI=1S/C29H36O3/c1-3-4-5-6-21-7-8-26-20-25(14-13-24(26)19-21)22-9-11-23(12-10-22)29(30)32-28-17-15-27(31-2)16-18-28/h3-4,9-12,15-18,21,24-26H,5-8,13-14,19-20H2,1-2H3/b4-3+ |
| InChIKey | VFPHIHCSAVEQQC-ONEGZZNKSA-N |
| XLogP | 7.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|