C28H29F2NO2 — CID 139870469
(4-cyano-3,5-difluorophenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 139870469) has the molecular formula C28H29F2NO2 and a molecular weight of 449.54 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 139870469 |
| Molecular Formula | C28H29F2NO2 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | C=CCCC1CCC2CC(c3ccc(C(=O)Oc4cc(F)c(C#N)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C28H29F2NO2/c1-2-3-4-18-5-6-23-14-22(12-11-21(23)13-18)19-7-9-20(10-8-19)28(32)33-24-15-26(29)25(17-31)27(30)16-24/h2,7-10,15-16,18,21-23H,1,3-6,11-14H2 |
| InChIKey | ICBQSGYLPPLWEZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|