C28H33NO2 — CID 22384978
(4-cyanophenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate (PubChem CID 22384978) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate.
| Compound Name | (4-cyanophenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
|---|---|
| PubChem CID | 22384978 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (4-cyanophenyl) 4-(6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoate |
| SMILES | CCCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(C#N)cc4)cc3)CCC2C1 |
| InChI | InChI=1S/C28H33NO2/c1-2-3-4-20-5-8-26-18-25(14-13-24(26)17-20)22-9-11-23(12-10-22)28(30)31-27-15-6-21(19-29)7-16-27/h6-7,9-12,15-16,20,24-26H,2-5,8,13-14,17-18H2,1H3 |
| InChIKey | WMFYPHSBOKBMRZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|