C23H31NO2 — CID 86317883
[(2R,4aR,6R,8aS)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-cyanobenzoate (PubChem CID 86317883) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is [(2R,4aR,6R,8aS)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-cyanobenzoate.
| Compound Name | [(2R,4aR,6R,8aS)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 86317883 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | [(2R,4aR,6R,8aS)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-cyanobenzoate |
| SMILES | CCCCC[C@@H]1CC[C@H]2C[C@H](OC(=O)c3ccc(C#N)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C23H31NO2/c1-2-3-4-5-17-6-11-21-15-22(13-12-20(21)14-17)26-23(25)19-9-7-18(16-24)8-10-19/h7-10,17,20-22H,2-6,11-15H2,1H3/t17-,20-,21+,22-/m1/s1 |
| InChIKey | OXZATOZCOBSUCE-HLRQEUIKSA-N |
| XLogP | 5.88 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|