C35H55NO3 — CID 19846955
[4-(4-hexylcyclohexyl)cyclohexyl] 3-cyano-4-nonoxybenzoate (PubChem CID 19846955) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is [4-(4-hexylcyclohexyl)cyclohexyl] 3-cyano-4-nonoxybenzoate.
| Compound Name | [4-(4-hexylcyclohexyl)cyclohexyl] 3-cyano-4-nonoxybenzoate |
|---|---|
| PubChem CID | 19846955 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | [4-(4-hexylcyclohexyl)cyclohexyl] 3-cyano-4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)OC2CCC(C3CCC(CCCCCC)CC3)CC2)cc1C#N |
| InChI | InChI=1S/C35H55NO3/c1-3-5-7-9-10-11-13-25-38-34-24-21-31(26-32(34)27-36)35(37)39-33-22-19-30(20-23-33)29-17-15-28(16-18-29)14-12-8-6-4-2/h21,24,26,28-30,33H,3-20,22-23,25H2,1-2H3 |
| InChIKey | UIFURYBAZYDPHF-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|