C30H38FNO3 — CID 54147544
(4-cyano-3-fluorophenyl) 4-[3-(4-heptylcyclohexyl)propoxy]benzoate (PubChem CID 54147544) has the molecular formula C30H38FNO3 and a molecular weight of 479.64 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[3-(4-heptylcyclohexyl)propoxy]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[3-(4-heptylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 54147544 |
| Molecular Formula | C30H38FNO3 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[3-(4-heptylcyclohexyl)propoxy]benzoate |
| SMILES | CCCCCCCC1CCC(CCCOc2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C30H38FNO3/c1-2-3-4-5-6-8-23-10-12-24(13-11-23)9-7-20-34-27-17-14-25(15-18-27)30(33)35-28-19-16-26(22-32)29(31)21-28/h14-19,21,23-24H,2-13,20H2,1H3 |
| InChIKey | OFLNKCRNHJTKSS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|