C32H42FNO3 — CID 67884566
(4-cyano-3-fluorophenyl) 4-[3-(2-nonylcyclohexyl)propoxy]benzoate (PubChem CID 67884566) has the molecular formula C32H42FNO3 and a molecular weight of 507.69 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[3-(2-nonylcyclohexyl)propoxy]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[3-(2-nonylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 67884566 |
| Molecular Formula | C32H42FNO3 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[3-(2-nonylcyclohexyl)propoxy]benzoate |
| SMILES | CCCCCCCCCC1CCCCC1CCCOc1ccc(C(=O)Oc2ccc(C#N)c(F)c2)cc1 |
| InChI | InChI=1S/C32H42FNO3/c1-2-3-4-5-6-7-8-12-25-13-9-10-14-26(25)15-11-22-36-29-19-16-27(17-20-29)32(35)37-30-21-18-28(24-34)31(33)23-30/h16-21,23,25-26H,2-15,22H2,1H3 |
| InChIKey | DVVIBTPLHPAOHI-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|