C21H28FNO2 — CID 67789985
(4-cyano-3-fluorophenyl) 3-(4-pentylcyclohexyl)propanoate (PubChem CID 67789985) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 3-(4-pentylcyclohexyl)propanoate.
| Compound Name | (4-cyano-3-fluorophenyl) 3-(4-pentylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 67789985 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 3-(4-pentylcyclohexyl)propanoate |
| SMILES | CCCCCC1CCC(CCC(=O)Oc2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C21H28FNO2/c1-2-3-4-5-16-6-8-17(9-7-16)10-13-21(24)25-19-12-11-18(15-23)20(22)14-19/h11-12,14,16-17H,2-10,13H2,1H3 |
| InChIKey | ZOTJWKSOLPABKY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|