C20H24N2O2 — CID 22359273
(3,4-dicyanophenyl) 4-pentylcyclohexane-1-carboxylate (PubChem CID 22359273) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3,4-dicyanophenyl) 4-pentylcyclohexane-1-carboxylate.
| Compound Name | (3,4-dicyanophenyl) 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 22359273 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (3,4-dicyanophenyl) 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(C#N)c(C#N)c2)CC1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-3-4-5-15-6-8-16(9-7-15)20(23)24-19-11-10-17(13-21)18(12-19)14-22/h10-12,15-16H,2-9H2,1H3 |
| InChIKey | MRZZQZHMLFZVNL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|