C27H33NO2 — CID 70404440
[4-[2-(4-cyanophenyl)ethyl]phenyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 70404440) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is [4-[2-(4-cyanophenyl)ethyl]phenyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [4-[2-(4-cyanophenyl)ethyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 70404440 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | [4-[2-(4-cyanophenyl)ethyl]phenyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(CCc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C27H33NO2/c1-2-3-4-5-21-12-16-25(17-13-21)27(29)30-26-18-14-23(15-19-26)7-6-22-8-10-24(20-28)11-9-22/h8-11,14-15,18-19,21,25H,2-7,12-13,16-17H2,1H3 |
| InChIKey | DTACEXSYTSEOFR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|