C24H29N3O2 — CID 606843
[2-(4-cyanophenyl)pyrimidin-5-yl] 4-hexylcyclohexane-1-carboxylate (PubChem CID 606843) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is [2-(4-cyanophenyl)pyrimidin-5-yl] 4-hexylcyclohexane-1-carboxylate.
| Compound Name | [2-(4-cyanophenyl)pyrimidin-5-yl] 4-hexylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 606843 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [2-(4-cyanophenyl)pyrimidin-5-yl] 4-hexylcyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC(C(=O)Oc2cnc(-c3ccc(C#N)cc3)nc2)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-3-4-5-6-18-7-13-21(14-8-18)24(28)29-22-16-26-23(27-17-22)20-11-9-19(15-25)10-12-20/h9-12,16-18,21H,2-8,13-14H2,1H3 |
| InChIKey | RBAPAJQEVLQUBZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|