C33H50N2O3 — CID 22085460
[2-(4-decoxyphenyl)pyrimidin-5-yl] 4-(4-methylpentyl)cyclohexane-1-carboxylate (PubChem CID 22085460) has the molecular formula C33H50N2O3 and a molecular weight of 522.77 g/mol. Its IUPAC name is [2-(4-decoxyphenyl)pyrimidin-5-yl] 4-(4-methylpentyl)cyclohexane-1-carboxylate.
| Compound Name | [2-(4-decoxyphenyl)pyrimidin-5-yl] 4-(4-methylpentyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 22085460 |
| Molecular Formula | C33H50N2O3 |
| Molecular Weight | 522.77 g/mol |
| Exact Mass | 522.38 |
| IUPAC Name | [2-(4-decoxyphenyl)pyrimidin-5-yl] 4-(4-methylpentyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ncc(OC(=O)C3CCC(CCCC(C)C)CC3)cn2)cc1 |
| InChI | InChI=1S/C33H50N2O3/c1-4-5-6-7-8-9-10-11-23-37-30-21-19-28(20-22-30)32-34-24-31(25-35-32)38-33(36)29-17-15-27(16-18-29)14-12-13-26(2)3/h19-22,24-27,29H,4-18,23H2,1-3H3 |
| InChIKey | YIKWPEQDEXFFBM-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.77 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|