C31H44ClNO3 — CID 54452770
[5-chloro-6-(4-octoxyphenyl)-3-pyridinyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 54452770) has the molecular formula C31H44ClNO3 and a molecular weight of 514.15 g/mol. Its IUPAC name is [5-chloro-6-(4-octoxyphenyl)-3-pyridinyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [5-chloro-6-(4-octoxyphenyl)-3-pyridinyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54452770 |
| Molecular Formula | C31H44ClNO3 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | [5-chloro-6-(4-octoxyphenyl)-3-pyridinyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(OC(=O)C3CCC(CCCCC)CC3)cc2Cl)cc1 |
| InChI | InChI=1S/C31H44ClNO3/c1-3-5-7-8-9-11-21-35-27-19-17-25(18-20-27)30-29(32)22-28(23-33-30)36-31(34)26-15-13-24(14-16-26)12-10-6-4-2/h17-20,22-24,26H,3-16,21H2,1-2H3 |
| InChIKey | WWCDDHADTPCYNH-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|