About (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate
(3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate (PubChem CID 70559218) has the molecular formula C20H26ClNO2
and a molecular weight of 347.89 g/mol. Its IUPAC name is (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate |
| PubChem CID | 70559218 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate |
| SMILES | CCCCCCC1CCC(C(=O)Oc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H26ClNO2/c1-2-3-4-5-6-15-7-9-16(10-8-15)20(23)24-18-12-11-17(14-22)19(21)13-18/h11-13,15-16H,2-10H2,1H3 |
| InChIKey | DXRINXFAIRCGCO-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate?
The IUPAC name of (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate (CID 70559218) is (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate.
What is the SMILES notation for (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate?
The canonical SMILES for (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate is CCCCCCC1CCC(C(=O)Oc2ccc(C#N)c(Cl)c2)CC1.
What is the InChIKey of (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate?
The InChIKey is DXRINXFAIRCGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26ClNO2/c1-2-3-4-5-6-15-7-9-16(10-8-15)20(23)24-18-12-11-17(14-22)19(21)13-18/h11-13,15-16H,2-10H2,1H3.
What are the key properties of (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate?
(3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate has a molecular weight of 347.89 g/mol, XLogP of 5.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-cyanophenyl) 4-hexylcyclohexane-1-carboxylate is sourced from PubChem (CID 70559218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).