C28H33ClO4 — CID 70560451
2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylcyclohexanecarbonyl)oxybenzoate (PubChem CID 70560451) has the molecular formula C28H33ClO4 and a molecular weight of 469.02 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylcyclohexanecarbonyl)oxybenzoate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylcyclohexanecarbonyl)oxybenzoate |
|---|---|
| PubChem CID | 70560451 |
| Molecular Formula | C28H33ClO4 |
| Molecular Weight | 469.02 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl 2-chloro-4-(4-pentylcyclohexanecarbonyl)oxybenzoate |
| SMILES | CCCCCC1CCC(C(=O)Oc2ccc(C(=O)OC3Cc4ccccc4C3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H33ClO4/c1-2-3-4-7-19-10-12-20(13-11-19)27(30)32-23-14-15-25(26(29)18-23)28(31)33-24-16-21-8-5-6-9-22(21)17-24/h5-6,8-9,14-15,18-20,24H,2-4,7,10-13,16-17H2,1H3 |
| InChIKey | PPAZDSRIYDROSZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.02 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|